About Diethylethoxysilane
Diethylethoxysilane (PubChem CID 12696169) has the molecular formula C6H15OSi
and a molecular weight of 131.27 g/mol.
Molecular Properties
| Compound Name | Diethylethoxysilane |
| PubChem CID | 12696169 |
| Molecular Formula | C6H15OSi |
| Molecular Weight | 131.27 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | — |
| SMILES | CCO[Si](CC)CC |
| InChI | InChI=1S/C6H15OSi/c1-4-7-8(5-2)6-3/h4-6H2,1-3H3 |
| InChIKey | GXWNIJSDXUBBNF-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Diethylethoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diethylethoxysilane?
The IUPAC name of Diethylethoxysilane (CID 12696169) is not available.
What is the SMILES notation for Diethylethoxysilane?
The canonical SMILES for Diethylethoxysilane is CCO[Si](CC)CC.
What is the InChIKey of Diethylethoxysilane?
The InChIKey is GXWNIJSDXUBBNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15OSi/c1-4-7-8(5-2)6-3/h4-6H2,1-3H3.
What are the key properties of Diethylethoxysilane?
Diethylethoxysilane has a molecular weight of 131.27 g/mol, XLogP of 2.05, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Diethylethoxysilane is sourced from PubChem (CID 12696169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).