C46H45NO4 — CID 126961869
(2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(trityloxymethyl)piperidine (PubChem CID 126961869) has the molecular formula C46H45NO4 and a molecular weight of 675.87 g/mol. Its IUPAC name is (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(trityloxymethyl)piperidine.
| Compound Name | (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(trityloxymethyl)piperidine |
|---|---|
| PubChem CID | 126961869 |
| Molecular Formula | C46H45NO4 |
| Molecular Weight | 675.87 g/mol |
| Exact Mass | 675.33 |
| IUPAC Name | (2R,3R,4R,5S)-3,4,5-tris(phenylmethoxy)-2-(trityloxymethyl)piperidine |
| SMILES | c1ccc(CO[C@H]2[C@H](OCc3ccccc3)[C@@H](COC(c3ccccc3)(c3ccccc3)c3ccccc3)NC[C@@H]2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C46H45NO4/c1-7-19-36(20-8-1)32-48-43-31-47-42(44(49-33-37-21-9-2-10-22-37)45(43)50-34-38-23-11-3-12-24-38)35-51-46(39-25-13-4-14-26-39,40-27-15-5-16-28-40)41-29-17-6-18-30-41/h1-30,42-45,47H,31-35H2/t42-,43+,44-,45-/m1/s1 |
| InChIKey | NFVZYMIBZIXNJT-SDEIMAHSSA-N |
| XLogP | 8.72 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.87 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|