C17H17F3O2S — CID 126961905
methyl (3E,5E)-6-phenyl-2-prop-2-enyl-2-(trifluoromethylsulfanyl)hexa-3,5-dienoate (PubChem CID 126961905) has the molecular formula C17H17F3O2S and a molecular weight of 342.38 g/mol. Its IUPAC name is methyl (3E,5E)-6-phenyl-2-prop-2-enyl-2-(trifluoromethylsulfanyl)hexa-3,5-dienoate.
| Compound Name | methyl (3E,5E)-6-phenyl-2-prop-2-enyl-2-(trifluoromethylsulfanyl)hexa-3,5-dienoate |
|---|---|
| PubChem CID | 126961905 |
| Molecular Formula | C17H17F3O2S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | methyl (3E,5E)-6-phenyl-2-prop-2-enyl-2-(trifluoromethylsulfanyl)hexa-3,5-dienoate |
| SMILES | C=CCC(/C=C/C=C/c1ccccc1)(SC(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C17H17F3O2S/c1-3-12-16(15(21)22-2,23-17(18,19)20)13-8-7-11-14-9-5-4-6-10-14/h3-11,13H,1,12H2,2H3/b11-7+,13-8+ |
| InChIKey | VOOUWGPTWZRMBG-ZHSLHGDYSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|