C19H22ClN3O5S — CID 126962122
2-(5-chloro-2-hydroxy-N-methylanilino)-N-(3-morpholin-4-ylsulfonylphenyl)acetamide (PubChem CID 126962122) has the molecular formula C19H22ClN3O5S and a molecular weight of 439.92 g/mol. Its IUPAC name is 2-(5-chloro-2-hydroxy-N-methylanilino)-N-(3-morpholin-4-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(5-chloro-2-hydroxy-N-methylanilino)-N-(3-morpholin-4-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 126962122 |
| Molecular Formula | C19H22ClN3O5S |
| Molecular Weight | 439.92 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 2-(5-chloro-2-hydroxy-N-methylanilino)-N-(3-morpholin-4-ylsulfonylphenyl)acetamide |
| SMILES | CN(CC(=O)Nc1cccc(S(=O)(=O)N2CCOCC2)c1)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C19H22ClN3O5S/c1-22(17-11-14(20)5-6-18(17)24)13-19(25)21-15-3-2-4-16(12-15)29(26,27)23-7-9-28-10-8-23/h2-6,11-12,24H,7-10,13H2,1H3,(H,21,25) |
| InChIKey | YJOFVIHYKQOFIW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.92 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |