C20H28FN7O3S — CID 126962283
3-[[4-[2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl(ethyl)amino]-5-fluoropyrimidin-2-yl]amino]-4-methoxybenzenesulfonamide (PubChem CID 126962283) has the molecular formula C20H28FN7O3S and a molecular weight of 465.56 g/mol. Its IUPAC name is 3-[[4-[2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl(ethyl)amino]-5-fluoropyrimidin-2-yl]amino]-4-methoxybenzenesulfonamide.
| Compound Name | 3-[[4-[2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl(ethyl)amino]-5-fluoropyrimidin-2-yl]amino]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 126962283 |
| Molecular Formula | C20H28FN7O3S |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.20 |
| IUPAC Name | 3-[[4-[2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-4-yl(ethyl)amino]-5-fluoropyrimidin-2-yl]amino]-4-methoxybenzenesulfonamide |
| SMILES | CCN(c1nc(Nc2cc(S(N)(=O)=O)ccc2OC)ncc1F)C1CCCC2NNCC21 |
| InChI | InChI=1S/C20H28FN7O3S/c1-3-28(17-6-4-5-15-13(17)10-24-27-15)19-14(21)11-23-20(26-19)25-16-9-12(32(22,29)30)7-8-18(16)31-2/h7-9,11,13,15,17,24,27H,3-6,10H2,1-2H3,(H2,22,29,30)(H,23,25,26) |
| InChIKey | PAQNCIIXRMDMES-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 134.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |