C12H9Cl3N4O — CID 126962331
4-chloro-6-(2,4-dichlorophenyl)-5-[(E)-methoxyiminomethyl]pyrimidin-2-amine (PubChem CID 126962331) has the molecular formula C12H9Cl3N4O and a molecular weight of 331.59 g/mol. Its IUPAC name is 4-chloro-6-(2,4-dichlorophenyl)-5-[(E)-methoxyiminomethyl]pyrimidin-2-amine.
| Compound Name | 4-chloro-6-(2,4-dichlorophenyl)-5-[(E)-methoxyiminomethyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 126962331 |
| Molecular Formula | C12H9Cl3N4O |
| Molecular Weight | 331.59 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 4-chloro-6-(2,4-dichlorophenyl)-5-[(E)-methoxyiminomethyl]pyrimidin-2-amine |
| SMILES | CO/N=C/c1c(Cl)nc(N)nc1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H9Cl3N4O/c1-20-17-5-8-10(18-12(16)19-11(8)15)7-3-2-6(13)4-9(7)14/h2-5H,1H3,(H2,16,18,19)/b17-5+ |
| InChIKey | CPBOJALZSACSMZ-YAXRCOADSA-N |
| XLogP | 3.67 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.59 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|