C27H30ClF2N3O5S — CID 126962421
[4-[[(2S)-2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylacetyl]amino]cyclohexyl] hydrogen sulfate (PubChem CID 126962421) has the molecular formula C27H30ClF2N3O5S and a molecular weight of 582.07 g/mol. Its IUPAC name is [4-[[(2S)-2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylacetyl]amino]cyclohexyl] hydrogen sulfate.
| Compound Name | [4-[[(2S)-2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylacetyl]amino]cyclohexyl] hydrogen sulfate |
|---|---|
| PubChem CID | 126962421 |
| Molecular Formula | C27H30ClF2N3O5S |
| Molecular Weight | 582.07 g/mol |
| Exact Mass | 581.16 |
| IUPAC Name | [4-[[(2S)-2-[2-(4-chlorophenyl)-5,6-difluorobenzimidazol-1-yl]-2-cyclohexylacetyl]amino]cyclohexyl] hydrogen sulfate |
| SMILES | O=C(NC1CCC(OS(=O)(=O)O)CC1)[C@H](C1CCCCC1)n1c(-c2ccc(Cl)cc2)nc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C27H30ClF2N3O5S/c28-18-8-6-17(7-9-18)26-32-23-14-21(29)22(30)15-24(23)33(26)25(16-4-2-1-3-5-16)27(34)31-19-10-12-20(13-11-19)38-39(35,36)37/h6-9,14-16,19-20,25H,1-5,10-13H2,(H,31,34)(H,35,36,37)/t19?,20?,25-/m0/s1 |
| InChIKey | SEHWHKGFYAXJEE-FGJIOPLASA-N |
| XLogP | 6.00 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.07 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|