About 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one
1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one (PubChem CID 126962547) has the molecular formula C23H30N2O
and a molecular weight of 350.51 g/mol. Its IUPAC name is 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one.
Molecular Properties
| Compound Name | 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one |
| PubChem CID | 126962547 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one |
| SMILES | CC(C)CC1(CC(C)C)NC(=O)c2ccccc2N1Cc1ccccc1 |
| InChI | InChI=1S/C23H30N2O/c1-17(2)14-23(15-18(3)4)24-22(26)20-12-8-9-13-21(20)25(23)16-19-10-6-5-7-11-19/h5-13,17-18H,14-16H2,1-4H3,(H,24,26) |
| InChIKey | AQKIDJVVDJFWLH-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one?
The IUPAC name of 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one (CID 126962547) is 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one.
What is the SMILES notation for 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one?
The canonical SMILES for 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one is CC(C)CC1(CC(C)C)NC(=O)c2ccccc2N1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one?
The InChIKey is AQKIDJVVDJFWLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2O/c1-17(2)14-23(15-18(3)4)24-22(26)20-12-8-9-13-21(20)25(23)16-19-10-6-5-7-11-19/h5-13,17-18H,14-16H2,1-4H3,(H,24,26).
What are the key properties of 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one?
1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one has a molecular weight of 350.51 g/mol, XLogP of 5.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2,2-bis(2-methylpropyl)-3H-quinazolin-4-one is sourced from PubChem (CID 126962547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).