About (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one
(5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one (PubChem CID 126963298) has the molecular formula C21H16N4O2
and a molecular weight of 356.39 g/mol. Its IUPAC name is (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one.
Molecular Properties
| Compound Name | (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one |
| PubChem CID | 126963298 |
| Molecular Formula | C21H16N4O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one |
| SMILES | O=C1NN(c2ccccc2)C(c2cccnc2)=N/C1=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C21H16N4O2/c26-18-10-8-15(9-11-18)13-19-21(27)24-25(17-6-2-1-3-7-17)20(23-19)16-5-4-12-22-14-16/h1-14,26H,(H,24,27)/b19-13+ |
| InChIKey | SSWHBHQMBBUPRN-CPNJWEJPSA-N |
| XLogP | 3.13 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_six_het_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one?
The IUPAC name of (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one (CID 126963298) is (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one.
What is the SMILES notation for (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one?
The canonical SMILES for (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one is O=C1NN(c2ccccc2)C(c2cccnc2)=N/C1=C/c1ccc(O)cc1.
What is the InChIKey of (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one?
The InChIKey is SSWHBHQMBBUPRN-CPNJWEJPSA-N. The full InChI is InChI=1S/C21H16N4O2/c26-18-10-8-15(9-11-18)13-19-21(27)24-25(17-6-2-1-3-7-17)20(23-19)16-5-4-12-22-14-16/h1-14,26H,(H,24,27)/b19-13+.
What are the key properties of (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one?
(5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one has a molecular weight of 356.39 g/mol, XLogP of 3.13, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5E)-5-[(4-hydroxyphenyl)methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one is sourced from PubChem (CID 126963298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).