C23H21N5O — CID 126963300
(5E)-5-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one (PubChem CID 126963300) has the molecular formula C23H21N5O and a molecular weight of 383.46 g/mol. Its IUPAC name is (5E)-5-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one.
| Compound Name | (5E)-5-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 126963300 |
| Molecular Formula | C23H21N5O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | (5E)-5-[[4-(dimethylamino)phenyl]methylidene]-2-phenyl-3-pyridin-3-yl-1H-1,2,4-triazin-6-one |
| SMILES | CN(C)c1ccc(/C=C2/N=C(c3cccnc3)N(c3ccccc3)NC2=O)cc1 |
| InChI | InChI=1S/C23H21N5O/c1-27(2)19-12-10-17(11-13-19)15-21-23(29)26-28(20-8-4-3-5-9-20)22(25-21)18-7-6-14-24-16-18/h3-16H,1-2H3,(H,26,29)/b21-15+ |
| InChIKey | ZCBORCZXIYDHAE-RCCKNPSSSA-N |
| XLogP | 3.49 |
| TPSA | 60.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_six_het_D(1)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|