C7ClF7 — CID 12696400
1-[chloro(difluoro)methyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 12696400) has the molecular formula C7ClF7 and a molecular weight of 252.52 g/mol. Its IUPAC name is 1-[chloro(difluoro)methyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[chloro(difluoro)methyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 12696400 |
| Molecular Formula | C7ClF7 |
| Molecular Weight | 252.52 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | 1-[chloro(difluoro)methyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | Fc1c(F)c(F)c(C(F)(F)Cl)c(F)c1F |
| InChI | InChI=1S/C7ClF7/c8-7(14,15)1-2(9)4(11)6(13)5(12)3(1)10 |
| InChIKey | CDODMQQSMPMVAW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|