About 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride
1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride (PubChem CID 126964211) has the molecular formula C14H20Cl2F2N4
and a molecular weight of 353.24 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride.
Molecular Properties
| Compound Name | 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride |
| PubChem CID | 126964211 |
| Molecular Formula | C14H20Cl2F2N4 |
| Molecular Weight | 353.24 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride |
| SMILES | CN(C)c1ccc(CNc2cnn(CC(F)F)c2)cc1.Cl.Cl |
| InChI | InChI=1S/C14H18F2N4.2ClH/c1-19(2)13-5-3-11(4-6-13)7-17-12-8-18-20(9-12)10-14(15)16;;/h3-6,8-9,14,17H,7,10H2,1-2H3;2*1H |
| InChIKey | UQXMEMNOOKNMFN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.24 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride?
The IUPAC name of 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride (CID 126964211) is 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride.
What is the SMILES notation for 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride?
The canonical SMILES for 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride is CN(C)c1ccc(CNc2cnn(CC(F)F)c2)cc1.Cl.Cl.
What is the InChIKey of 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride?
The InChIKey is UQXMEMNOOKNMFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F2N4.2ClH/c1-19(2)13-5-3-11(4-6-13)7-17-12-8-18-20(9-12)10-14(15)16;;/h3-6,8-9,14,17H,7,10H2,1-2H3;2*1H.
What are the key properties of 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride?
1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride has a molecular weight of 353.24 g/mol, XLogP of 3.67, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-difluoroethyl)-N-[[4-(dimethylamino)phenyl]methyl]pyrazol-4-amine;dihydrochloride is sourced from PubChem (CID 126964211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).