C13H18ClN3O2 — CID 126965409
2-[4-[(4-methoxyphenyl)methylamino]pyrazol-1-yl]ethanol;hydrochloride (PubChem CID 126965409) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-[4-[(4-methoxyphenyl)methylamino]pyrazol-1-yl]ethanol;hydrochloride.
| Compound Name | 2-[4-[(4-methoxyphenyl)methylamino]pyrazol-1-yl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 126965409 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-[4-[(4-methoxyphenyl)methylamino]pyrazol-1-yl]ethanol;hydrochloride |
| SMILES | COc1ccc(CNc2cnn(CCO)c2)cc1.Cl |
| InChI | InChI=1S/C13H17N3O2.ClH/c1-18-13-4-2-11(3-5-13)8-14-12-9-15-16(10-12)6-7-17;/h2-5,9-10,14,17H,6-8H2,1H3;1H |
| InChIKey | DBDOEOOXZFVDRR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |