C13H28Cl2N4 — CID 126965686
N',N'-dimethyl-N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]propane-1,3-diamine;dihydrochloride (PubChem CID 126965686) has the molecular formula C13H28Cl2N4 and a molecular weight of 311.30 g/mol. Its IUPAC name is N',N'-dimethyl-N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]propane-1,3-diamine;dihydrochloride.
| Compound Name | N',N'-dimethyl-N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]propane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 126965686 |
| Molecular Formula | C13H28Cl2N4 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N',N'-dimethyl-N-[[2-(2-methylpropyl)pyrazol-3-yl]methyl]propane-1,3-diamine;dihydrochloride |
| SMILES | CC(C)Cn1nccc1CNCCCN(C)C.Cl.Cl |
| InChI | InChI=1S/C13H26N4.2ClH/c1-12(2)11-17-13(6-8-15-17)10-14-7-5-9-16(3)4;;/h6,8,12,14H,5,7,9-11H2,1-4H3;2*1H |
| InChIKey | VRVCCDFJGDSZEY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|