About N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine
N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine (PubChem CID 12696605) has the molecular formula C9H16N2O
and a molecular weight of 170.25 g/mol. Its IUPAC name is N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine |
| PubChem CID | 12696605 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine |
| SMILES | [2H]C1([2H])COC(NC2CCCCC2)=N1 |
| InChI | InChI=1S/C9H16N2O/c1-2-4-8(5-3-1)11-9-10-6-7-12-9/h8H,1-7H2,(H,10,11)/i6D2 |
| InChIKey | XTZPBUFHOVLKQR-NCYHJHSESA-N |
| XLogP | 1.29 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine?
The IUPAC name of N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine (CID 12696605) is N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine.
What is the SMILES notation for N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine?
The canonical SMILES for N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine is [2H]C1([2H])COC(NC2CCCCC2)=N1.
What is the InChIKey of N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine?
The InChIKey is XTZPBUFHOVLKQR-NCYHJHSESA-N. The full InChI is InChI=1S/C9H16N2O/c1-2-4-8(5-3-1)11-9-10-6-7-12-9/h8H,1-7H2,(H,10,11)/i6D2.
What are the key properties of N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine?
N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine has a molecular weight of 170.25 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-4,4-dideuterio-5H-1,3-oxazol-2-amine is sourced from PubChem (CID 12696605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).