C15H22ClN3 — CID 126966390
2-phenyl-N-[(1-propylpyrazol-4-yl)methyl]ethanamine;hydrochloride (PubChem CID 126966390) has the molecular formula C15H22ClN3 and a molecular weight of 279.81 g/mol. Its IUPAC name is 2-phenyl-N-[(1-propylpyrazol-4-yl)methyl]ethanamine;hydrochloride.
| Compound Name | 2-phenyl-N-[(1-propylpyrazol-4-yl)methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 126966390 |
| Molecular Formula | C15H22ClN3 |
| Molecular Weight | 279.81 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-phenyl-N-[(1-propylpyrazol-4-yl)methyl]ethanamine;hydrochloride |
| SMILES | CCCn1cc(CNCCc2ccccc2)cn1.Cl |
| InChI | InChI=1S/C15H21N3.ClH/c1-2-10-18-13-15(12-17-18)11-16-9-8-14-6-4-3-5-7-14;/h3-7,12-13,16H,2,8-11H2,1H3;1H |
| InChIKey | OKPBJGMJPWFOGN-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.81 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|