C13H18ClF2N5 — CID 126966683
N-[(1-cyclopentylpyrazol-4-yl)methyl]-1-(difluoromethyl)pyrazol-3-amine;hydrochloride (PubChem CID 126966683) has the molecular formula C13H18ClF2N5 and a molecular weight of 317.77 g/mol. Its IUPAC name is N-[(1-cyclopentylpyrazol-4-yl)methyl]-1-(difluoromethyl)pyrazol-3-amine;hydrochloride.
| Compound Name | N-[(1-cyclopentylpyrazol-4-yl)methyl]-1-(difluoromethyl)pyrazol-3-amine;hydrochloride |
|---|---|
| PubChem CID | 126966683 |
| Molecular Formula | C13H18ClF2N5 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[(1-cyclopentylpyrazol-4-yl)methyl]-1-(difluoromethyl)pyrazol-3-amine;hydrochloride |
| SMILES | Cl.FC(F)n1ccc(NCc2cnn(C3CCCC3)c2)n1 |
| InChI | InChI=1S/C13H17F2N5.ClH/c14-13(15)19-6-5-12(18-19)16-7-10-8-17-20(9-10)11-3-1-2-4-11;/h5-6,8-9,11,13H,1-4,7H2,(H,16,18);1H |
| InChIKey | QHIYQHNJBDUDKD-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |