C12H13ClF3N3 — CID 126966938
1-(difluoromethyl)-N-[(3-fluorophenyl)methyl]-3-methylpyrazol-4-amine;hydrochloride (PubChem CID 126966938) has the molecular formula C12H13ClF3N3 and a molecular weight of 291.70 g/mol. Its IUPAC name is 1-(difluoromethyl)-N-[(3-fluorophenyl)methyl]-3-methylpyrazol-4-amine;hydrochloride.
| Compound Name | 1-(difluoromethyl)-N-[(3-fluorophenyl)methyl]-3-methylpyrazol-4-amine;hydrochloride |
|---|---|
| PubChem CID | 126966938 |
| Molecular Formula | C12H13ClF3N3 |
| Molecular Weight | 291.70 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 1-(difluoromethyl)-N-[(3-fluorophenyl)methyl]-3-methylpyrazol-4-amine;hydrochloride |
| SMILES | Cc1nn(C(F)F)cc1NCc1cccc(F)c1.Cl |
| InChI | InChI=1S/C12H12F3N3.ClH/c1-8-11(7-18(17-8)12(14)15)16-6-9-3-2-4-10(13)5-9;/h2-5,7,12,16H,6H2,1H3;1H |
| InChIKey | KFPWVHFSAOZFNK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.70 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |