About CID 12696721
CID 12696721 (PubChem CID 12696721) has the molecular formula C5H9
and a molecular weight of 69.13 g/mol.
Molecular Properties
| Compound Name | CID 12696721 |
| PubChem CID | 12696721 |
| Molecular Formula | C5H9 |
| Molecular Weight | 69.13 g/mol |
| Exact Mass | 69.07 |
| IUPAC Name | — |
| SMILES | C[C]=C(C)C |
| InChI | InChI=1S/C5H9/c1-4-5(2)3/h1-3H3 |
| InChIKey | QEDJNWQOUQRANM-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 69.13 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 12696721 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12696721?
The IUPAC name of CID 12696721 (CID 12696721) is not available.
What is the SMILES notation for CID 12696721?
The canonical SMILES for CID 12696721 is C[C]=C(C)C.
What is the InChIKey of CID 12696721?
The InChIKey is QEDJNWQOUQRANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9/c1-4-5(2)3/h1-3H3.
What are the key properties of CID 12696721?
CID 12696721 has a molecular weight of 69.13 g/mol, XLogP of 1.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12696721 is sourced from PubChem (CID 12696721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).