C11H22ClN3 — CID 126967489
N-[(2-propan-2-ylpyrazol-3-yl)methyl]butan-1-amine;hydrochloride (PubChem CID 126967489) has the molecular formula C11H22ClN3 and a molecular weight of 231.77 g/mol. Its IUPAC name is N-[(2-propan-2-ylpyrazol-3-yl)methyl]butan-1-amine;hydrochloride.
| Compound Name | N-[(2-propan-2-ylpyrazol-3-yl)methyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 126967489 |
| Molecular Formula | C11H22ClN3 |
| Molecular Weight | 231.77 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | N-[(2-propan-2-ylpyrazol-3-yl)methyl]butan-1-amine;hydrochloride |
| SMILES | CCCCNCc1ccnn1C(C)C.Cl |
| InChI | InChI=1S/C11H21N3.ClH/c1-4-5-7-12-9-11-6-8-13-14(11)10(2)3;/h6,8,10,12H,4-5,7,9H2,1-3H3;1H |
| InChIKey | OIFQVSXBGFHUCK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.77 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|