About 4-cyclohexylphosphinine
4-cyclohexylphosphinine (PubChem CID 12696907) has the molecular formula C11H15P
and a molecular weight of 178.22 g/mol. Its IUPAC name is 4-cyclohexylphosphinine.
Molecular Properties
| Compound Name | 4-cyclohexylphosphinine |
| PubChem CID | 12696907 |
| Molecular Formula | C11H15P |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 4-cyclohexylphosphinine |
| SMILES | c1cc(C2CCCCC2)ccp1 |
| InChI | InChI=1S/C11H15P/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h6-10H,1-5H2 |
| InChIKey | XQVQUZIUBSXHLP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-cyclohexylphosphinine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexylphosphinine?
The IUPAC name of 4-cyclohexylphosphinine (CID 12696907) is 4-cyclohexylphosphinine.
What is the SMILES notation for 4-cyclohexylphosphinine?
The canonical SMILES for 4-cyclohexylphosphinine is c1cc(C2CCCCC2)ccp1.
What is the InChIKey of 4-cyclohexylphosphinine?
The InChIKey is XQVQUZIUBSXHLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15P/c1-2-4-10(5-3-1)11-6-8-12-9-7-11/h6-10H,1-5H2.
What are the key properties of 4-cyclohexylphosphinine?
4-cyclohexylphosphinine has a molecular weight of 178.22 g/mol, XLogP of 4.31, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexylphosphinine is sourced from PubChem (CID 12696907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).