About 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole
2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 12696967) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole.
Analyze 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole?
The IUPAC name of 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole (CID 12696967) is 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole.
What is the SMILES notation for 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole?
The canonical SMILES for 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole is Cc1nc2c(s1)CCCC2.
What is the InChIKey of 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole?
The InChIKey is DQMSQXZUGHBBDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-6-9-7-4-2-3-5-8(7)10-6/h2-5H2,1H3.
What are the key properties of 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole?
2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole has a molecular weight of 153.25 g/mol, XLogP of 2.33, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazole is sourced from PubChem (CID 12696967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).