About cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride
cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride (PubChem CID 126970325) has the molecular formula C6H14ClNO
and a molecular weight of 151.64 g/mol. Its IUPAC name is cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride.
Molecular Properties
| Compound Name | cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride |
| PubChem CID | 126970325 |
| Molecular Formula | C6H14ClNO |
| Molecular Weight | 151.64 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride |
| SMILES | CC1(C)[C@H](N)C[C@@H]1O.Cl |
| InChI | InChI=1S/C6H13NO.ClH/c1-6(2)4(7)3-5(6)8;/h4-5,8H,3,7H2,1-2H3;1H/t4-,5+;/m1./s1 |
| InChIKey | ITVWYQLMVRTELZ-JBUOLDKXSA-N |
| XLogP | 0.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.64 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride?
The IUPAC name of cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride (CID 126970325) is cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride.
What is the SMILES notation for cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride?
The canonical SMILES for cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride is CC1(C)[C@H](N)C[C@@H]1O.Cl.
What is the InChIKey of cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride?
The InChIKey is ITVWYQLMVRTELZ-JBUOLDKXSA-N. The full InChI is InChI=1S/C6H13NO.ClH/c1-6(2)4(7)3-5(6)8;/h4-5,8H,3,7H2,1-2H3;1H/t4-,5+;/m1./s1.
What are the key properties of cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride?
cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride has a molecular weight of 151.64 g/mol, XLogP of 0.53, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-3-amino-2,2-dimethylcyclobutan-1-ol;hydrochloride is sourced from PubChem (CID 126970325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).