About 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one
5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 126970396) has the molecular formula C6H3F2N3O
and a molecular weight of 171.11 g/mol. Its IUPAC name is 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| PubChem CID | 126970396 |
| Molecular Formula | C6H3F2N3O |
| Molecular Weight | 171.11 g/mol |
| Exact Mass | 171.02 |
| IUPAC Name | 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | O=C1Nc2ncncc2C1(F)F |
| InChI | InChI=1S/C6H3F2N3O/c7-6(8)3-1-9-2-10-4(3)11-5(6)12/h1-2H,(H,9,10,11,12) |
| InChIKey | HSKAJHFUWPMFKC-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.11 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one?
The IUPAC name of 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one (CID 126970396) is 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one.
What is the SMILES notation for 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one?
The canonical SMILES for 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one is O=C1Nc2ncncc2C1(F)F.
What is the InChIKey of 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one?
The InChIKey is HSKAJHFUWPMFKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F2N3O/c7-6(8)3-1-9-2-10-4(3)11-5(6)12/h1-2H,(H,9,10,11,12).
What are the key properties of 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one?
5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one has a molecular weight of 171.11 g/mol, XLogP of 0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-difluoro-7H-pyrrolo[2,3-d]pyrimidin-6-one is sourced from PubChem (CID 126970396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).