About 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride
5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride (PubChem CID 126970582) has the molecular formula C8H18Cl2N2
and a molecular weight of 213.15 g/mol. Its IUPAC name is 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride.
Molecular Properties
| Compound Name | 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride |
| PubChem CID | 126970582 |
| Molecular Formula | C8H18Cl2N2 |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride |
| SMILES | CN1CCCCC12CNC2.Cl.Cl |
| InChI | InChI=1S/C8H16N2.2ClH/c1-10-5-3-2-4-8(10)6-9-7-8;;/h9H,2-7H2,1H3;2*1H |
| InChIKey | HSVINGGKZNDZCS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride?
The IUPAC name of 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride (CID 126970582) is 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride.
What is the SMILES notation for 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride?
The canonical SMILES for 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride is CN1CCCCC12CNC2.Cl.Cl.
What is the InChIKey of 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride?
The InChIKey is HSVINGGKZNDZCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2.2ClH/c1-10-5-3-2-4-8(10)6-9-7-8;;/h9H,2-7H2,1H3;2*1H.
What are the key properties of 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride?
5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride has a molecular weight of 213.15 g/mol, XLogP of 1.29, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2,5-diazaspiro[3.5]nonane;dihydrochloride is sourced from PubChem (CID 126970582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).