C20H24BN3O4S — CID 126970599
6-methyl-7-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine (PubChem CID 126970599) has the molecular formula C20H24BN3O4S and a molecular weight of 413.31 g/mol. Its IUPAC name is 6-methyl-7-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine.
| Compound Name | 6-methyl-7-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 126970599 |
| Molecular Formula | C20H24BN3O4S |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 6-methyl-7-(4-methylphenyl)sulfonyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrrolo[2,3-d]pyrimidine |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C)c(B3OC(C)(C)C(C)(C)O3)c3cncnc32)cc1 |
| InChI | InChI=1S/C20H24BN3O4S/c1-13-7-9-15(10-8-13)29(25,26)24-14(2)17(16-11-22-12-23-18(16)24)21-27-19(3,4)20(5,6)28-21/h7-12H,1-6H3 |
| InChIKey | XVNHRULECTVBLX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|