C27H38F6O2Si2 — CID 126970744
tert-butyl-[4-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-dimethylsilane (PubChem CID 126970744) has the molecular formula C27H38F6O2Si2 and a molecular weight of 564.76 g/mol. Its IUPAC name is tert-butyl-[4-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[4-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 126970744 |
| Molecular Formula | C27H38F6O2Si2 |
| Molecular Weight | 564.76 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | tert-butyl-[4-[2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C(c2ccc(O[Si](C)(C)C(C)(C)C)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H38F6O2Si2/c1-23(2,3)36(7,8)34-21-15-11-19(12-16-21)25(26(28,29)30,27(31,32)33)20-13-17-22(18-14-20)35-37(9,10)24(4,5)6/h11-18H,1-10H3 |
| InChIKey | ZABJYPWSGNSHFB-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.76 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|