About [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol
[4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol (PubChem CID 126970901) has the molecular formula C7H9NO3S
and a molecular weight of 187.22 g/mol. Its IUPAC name is [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol.
Molecular Properties
| Compound Name | [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol |
| PubChem CID | 126970901 |
| Molecular Formula | C7H9NO3S |
| Molecular Weight | 187.22 g/mol |
| Exact Mass | 187.03 |
| IUPAC Name | [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol |
| SMILES | OCc1nc(C2OCCO2)cs1 |
| InChI | InChI=1S/C7H9NO3S/c9-3-6-8-5(4-12-6)7-10-1-2-11-7/h4,7,9H,1-3H2 |
| InChIKey | PZBQWBFDQOHHGL-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.22 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol?
The IUPAC name of [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol (CID 126970901) is [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol.
What is the SMILES notation for [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol?
The canonical SMILES for [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol is OCc1nc(C2OCCO2)cs1.
What is the InChIKey of [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol?
The InChIKey is PZBQWBFDQOHHGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c9-3-6-8-5(4-12-6)7-10-1-2-11-7/h4,7,9H,1-3H2.
What are the key properties of [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol?
[4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol has a molecular weight of 187.22 g/mol, XLogP of 0.68, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1,3-dioxolan-2-yl)-1,3-thiazol-2-yl]methanol is sourced from PubChem (CID 126970901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).