C5H7FN4O2 — CID 126973630
6-(2-fluoroethylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 126973630) has the molecular formula C5H7FN4O2 and a molecular weight of 174.13 g/mol. Its IUPAC name is 6-(2-fluoroethylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(2-fluoroethylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 126973630 |
| Molecular Formula | C5H7FN4O2 |
| Molecular Weight | 174.13 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 6-(2-fluoroethylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NCCF)c(=O)[nH]1 |
| InChI | InChI=1S/C5H7FN4O2/c6-1-2-7-3-4(11)8-5(12)10-9-3/h1-2H2,(H,7,9)(H2,8,10,11,12) |
| InChIKey | BVWMPIHAGFRCMD-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.13 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |