C9H16N2 — CID 126973820
1-(1-ethyl-2-methylpyrrol-3-yl)-N-methylmethanamine (PubChem CID 126973820) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-(1-ethyl-2-methylpyrrol-3-yl)-N-methylmethanamine.
| Compound Name | 1-(1-ethyl-2-methylpyrrol-3-yl)-N-methylmethanamine |
|---|---|
| PubChem CID | 126973820 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-(1-ethyl-2-methylpyrrol-3-yl)-N-methylmethanamine |
| SMILES | CCn1ccc(CNC)c1C |
| InChI | InChI=1S/C9H16N2/c1-4-11-6-5-9(7-10-3)8(11)2/h5-6,10H,4,7H2,1-3H3 |
| InChIKey | FDBHHNLBOUVCJW-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |