C11H12Cl2O — CID 126973912
5-chloro-7-(2-chloropropyl)-2,3-dihydro-1-benzofuran (PubChem CID 126973912) has the molecular formula C11H12Cl2O and a molecular weight of 231.12 g/mol. Its IUPAC name is 5-chloro-7-(2-chloropropyl)-2,3-dihydro-1-benzofuran.
| Compound Name | 5-chloro-7-(2-chloropropyl)-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 126973912 |
| Molecular Formula | C11H12Cl2O |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 5-chloro-7-(2-chloropropyl)-2,3-dihydro-1-benzofuran |
| SMILES | CC(Cl)Cc1cc(Cl)cc2c1OCC2 |
| InChI | InChI=1S/C11H12Cl2O/c1-7(12)4-9-6-10(13)5-8-2-3-14-11(8)9/h5-7H,2-4H2,1H3 |
| InChIKey | GLCYYOGOZJOSSH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|