About 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane
3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane (PubChem CID 126974567) has the molecular formula C11H19ClF2
and a molecular weight of 224.72 g/mol. Its IUPAC name is 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane.
Molecular Properties
| Compound Name | 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane |
| PubChem CID | 126974567 |
| Molecular Formula | C11H19ClF2 |
| Molecular Weight | 224.72 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane |
| SMILES | CC(C)(CCl)CC1CCCC(F)(F)C1 |
| InChI | InChI=1S/C11H19ClF2/c1-10(2,8-12)6-9-4-3-5-11(13,14)7-9/h9H,3-8H2,1-2H3 |
| InChIKey | CQGMNBORQWNSAJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.72 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane?
The IUPAC name of 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane (CID 126974567) is 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane.
What is the SMILES notation for 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane?
The canonical SMILES for 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane is CC(C)(CCl)CC1CCCC(F)(F)C1.
What is the InChIKey of 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane?
The InChIKey is CQGMNBORQWNSAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19ClF2/c1-10(2,8-12)6-9-4-3-5-11(13,14)7-9/h9H,3-8H2,1-2H3.
What are the key properties of 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane?
3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane has a molecular weight of 224.72 g/mol, XLogP of 4.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-2,2-dimethylpropyl)-1,1-difluorocyclohexane is sourced from PubChem (CID 126974567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).