C5H9FN4S — CID 126976305
5-N-(3-fluoropropyl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 126976305) has the molecular formula C5H9FN4S and a molecular weight of 176.22 g/mol. Its IUPAC name is 5-N-(3-fluoropropyl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N-(3-fluoropropyl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 126976305 |
| Molecular Formula | C5H9FN4S |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 5-N-(3-fluoropropyl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | Nc1nsc(NCCCF)n1 |
| InChI | InChI=1S/C5H9FN4S/c6-2-1-3-8-5-9-4(7)10-11-5/h1-3H2,(H3,7,8,9,10) |
| InChIKey | XMTMHVATKKIPRD-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|