C11H19N3 — CID 126977134
N-cyclopent-3-en-1-yl-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine (PubChem CID 126977134) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is N-cyclopent-3-en-1-yl-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine.
| Compound Name | N-cyclopent-3-en-1-yl-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 126977134 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-cyclopent-3-en-1-yl-5,5-dimethyl-4,6-dihydro-1H-pyrimidin-2-amine |
| SMILES | CC1(C)CN=C(NC2CC=CC2)NC1 |
| InChI | InChI=1S/C11H19N3/c1-11(2)7-12-10(13-8-11)14-9-5-3-4-6-9/h3-4,9H,5-8H2,1-2H3,(H2,12,13,14) |
| InChIKey | MGZLUTWPZUWHHP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|