C7F10 — CID 12697774
1,2,3,3,4,6,6-heptafluoro-5-(trifluoromethyl)cyclohexa-1,4-diene (PubChem CID 12697774) has the molecular formula C7F10 and a molecular weight of 274.06 g/mol. Its IUPAC name is 1,2,3,3,4,6,6-heptafluoro-5-(trifluoromethyl)cyclohexa-1,4-diene.
| Compound Name | 1,2,3,3,4,6,6-heptafluoro-5-(trifluoromethyl)cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 12697774 |
| Molecular Formula | C7F10 |
| Molecular Weight | 274.06 g/mol |
| Exact Mass | 273.98 |
| IUPAC Name | 1,2,3,3,4,6,6-heptafluoro-5-(trifluoromethyl)cyclohexa-1,4-diene |
| SMILES | FC1=C(F)C(F)(F)C(C(F)(F)F)=C(F)C1(F)F |
| InChI | InChI=1S/C7F10/c8-2-1(7(15,16)17)5(11,12)3(9)4(10)6(2,13)14 |
| InChIKey | VHSUBZSYLNJXLY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.06 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |