About 3,4-dimethyl-2,5-dihydrotellurophene
3,4-dimethyl-2,5-dihydrotellurophene (PubChem CID 12697841) has the molecular formula C6H10Te
and a molecular weight of 209.75 g/mol. Its IUPAC name is 3,4-dimethyl-2,5-dihydrotellurophene.
Molecular Properties
| Compound Name | 3,4-dimethyl-2,5-dihydrotellurophene |
| PubChem CID | 12697841 |
| Molecular Formula | C6H10Te |
| Molecular Weight | 209.75 g/mol |
| Exact Mass | 211.98 |
| IUPAC Name | 3,4-dimethyl-2,5-dihydrotellurophene |
| SMILES | CC1=C(C)C[Te]C1 |
| InChI | InChI=1S/C6H10Te/c1-5-3-7-4-6(5)2/h3-4H2,1-2H3 |
| InChIKey | ZVAKGWBVFDTMNQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.75 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-2,5-dihydrotellurophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2,5-dihydrotellurophene?
The IUPAC name of 3,4-dimethyl-2,5-dihydrotellurophene (CID 12697841) is 3,4-dimethyl-2,5-dihydrotellurophene.
What is the SMILES notation for 3,4-dimethyl-2,5-dihydrotellurophene?
The canonical SMILES for 3,4-dimethyl-2,5-dihydrotellurophene is CC1=C(C)C[Te]C1.
What is the InChIKey of 3,4-dimethyl-2,5-dihydrotellurophene?
The InChIKey is ZVAKGWBVFDTMNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10Te/c1-5-3-7-4-6(5)2/h3-4H2,1-2H3.
What are the key properties of 3,4-dimethyl-2,5-dihydrotellurophene?
3,4-dimethyl-2,5-dihydrotellurophene has a molecular weight of 209.75 g/mol, XLogP of 1.88, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2,5-dihydrotellurophene is sourced from PubChem (CID 12697841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).