C7H14FN3 — CID 126979416
N-(3-fluoropropyl)-1-methyl-4,5-dihydroimidazol-2-amine (PubChem CID 126979416) has the molecular formula C7H14FN3 and a molecular weight of 159.21 g/mol. Its IUPAC name is N-(3-fluoropropyl)-1-methyl-4,5-dihydroimidazol-2-amine.
| Compound Name | N-(3-fluoropropyl)-1-methyl-4,5-dihydroimidazol-2-amine |
|---|---|
| PubChem CID | 126979416 |
| Molecular Formula | C7H14FN3 |
| Molecular Weight | 159.21 g/mol |
| Exact Mass | 159.12 |
| IUPAC Name | N-(3-fluoropropyl)-1-methyl-4,5-dihydroimidazol-2-amine |
| SMILES | CN1CCN=C1NCCCF |
| InChI | InChI=1S/C7H14FN3/c1-11-6-5-10-7(11)9-4-2-3-8/h2-6H2,1H3,(H,9,10) |
| InChIKey | LVHGLUDSPIHZCX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|