About 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane
2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 126980121) has the molecular formula C7H12F2N2
and a molecular weight of 162.18 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane |
| PubChem CID | 126980121 |
| Molecular Formula | C7H12F2N2 |
| Molecular Weight | 162.18 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | FC(F)CN1CC2CC1CN2 |
| InChI | InChI=1S/C7H12F2N2/c8-7(9)4-11-3-5-1-6(11)2-10-5/h5-7,10H,1-4H2 |
| InChIKey | MBUDOQLVBKLJBO-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane?
The IUPAC name of 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane (CID 126980121) is 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane.
What is the SMILES notation for 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane?
The canonical SMILES for 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane is FC(F)CN1CC2CC1CN2.
What is the InChIKey of 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane?
The InChIKey is MBUDOQLVBKLJBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12F2N2/c8-7(9)4-11-3-5-1-6(11)2-10-5/h5-7,10H,1-4H2.
What are the key properties of 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane?
2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane has a molecular weight of 162.18 g/mol, XLogP of 0.30, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethyl)-2,5-diazabicyclo[2.2.1]heptane is sourced from PubChem (CID 126980121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).