C9H16N4O — CID 126982466
2-[5-[(1S)-1-aminoethyl]triazol-1-yl]cyclopentan-1-ol (PubChem CID 126982466) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-[5-[(1S)-1-aminoethyl]triazol-1-yl]cyclopentan-1-ol.
| Compound Name | 2-[5-[(1S)-1-aminoethyl]triazol-1-yl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 126982466 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 2-[5-[(1S)-1-aminoethyl]triazol-1-yl]cyclopentan-1-ol |
| SMILES | C[C@H](N)c1cnnn1C1CCCC1O |
| InChI | InChI=1S/C9H16N4O/c1-6(10)8-5-11-12-13(8)7-3-2-4-9(7)14/h5-7,9,14H,2-4,10H2,1H3/t6-,7?,9?/m0/s1 |
| InChIKey | AKLMRNGLWVGMTQ-PTNSZRNDSA-N |
| XLogP | 0.38 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |