C9H14N2OS — CID 126982770
2-methoxy-4-(2-methylpyrrolidin-2-yl)-1,3-thiazole (PubChem CID 126982770) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is 2-methoxy-4-(2-methylpyrrolidin-2-yl)-1,3-thiazole.
| Compound Name | 2-methoxy-4-(2-methylpyrrolidin-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 126982770 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-methoxy-4-(2-methylpyrrolidin-2-yl)-1,3-thiazole |
| SMILES | COc1nc(C2(C)CCCN2)cs1 |
| InChI | InChI=1S/C9H14N2OS/c1-9(4-3-5-10-9)7-6-13-8(11-7)12-2/h6,10H,3-5H2,1-2H3 |
| InChIKey | CIVPSMLTNJGMEK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |