About 2-cyclobutyl-3,3-dimethylazetidine
2-cyclobutyl-3,3-dimethylazetidine (PubChem CID 126983063) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is 2-cyclobutyl-3,3-dimethylazetidine.
Molecular Properties
| Compound Name | 2-cyclobutyl-3,3-dimethylazetidine |
| PubChem CID | 126983063 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 2-cyclobutyl-3,3-dimethylazetidine |
| SMILES | CC1(C)CNC1C1CCC1 |
| InChI | InChI=1S/C9H17N/c1-9(2)6-10-8(9)7-4-3-5-7/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | BVGVBWZEDRHIOR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclobutyl-3,3-dimethylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclobutyl-3,3-dimethylazetidine?
The IUPAC name of 2-cyclobutyl-3,3-dimethylazetidine (CID 126983063) is 2-cyclobutyl-3,3-dimethylazetidine.
What is the SMILES notation for 2-cyclobutyl-3,3-dimethylazetidine?
The canonical SMILES for 2-cyclobutyl-3,3-dimethylazetidine is CC1(C)CNC1C1CCC1.
What is the InChIKey of 2-cyclobutyl-3,3-dimethylazetidine?
The InChIKey is BVGVBWZEDRHIOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N/c1-9(2)6-10-8(9)7-4-3-5-7/h7-8,10H,3-6H2,1-2H3.
What are the key properties of 2-cyclobutyl-3,3-dimethylazetidine?
2-cyclobutyl-3,3-dimethylazetidine has a molecular weight of 139.24 g/mol, XLogP of 1.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclobutyl-3,3-dimethylazetidine is sourced from PubChem (CID 126983063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).