triethylazanium chloride

C6H16ClN — CID 12698378

IUPACtriethylazanium chloride
SMILESCC[NH+](CC)CC.[Cl-]
InChIInChI=1S/C6H15N.ClH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H
InChIKeyILWRPSCZWQJDMK-UHFFFAOYSA-N
MW137.65 g/mol
LogP-3.07
Rot. Bonds3

About triethylazanium chloride

triethylazanium chloride (PubChem CID 12698378) has the molecular formula C6H16ClN and a molecular weight of 137.65 g/mol. Its IUPAC name is triethylazanium chloride.

Molecular Properties

Compound Nametriethylazanium chloride
PubChem CID12698378
Molecular FormulaC6H16ClN
Molecular Weight137.65 g/mol
Exact Mass137.10
IUPAC Nametriethylazanium chloride
SMILESCC[NH+](CC)CC.[Cl-]
InChIInChI=1S/C6H15N.ClH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H
InChIKeyILWRPSCZWQJDMK-UHFFFAOYSA-N
XLogP-3.07
TPSA4.44 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500137.65
LogP ≤ 5-3.07
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Analyze triethylazanium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

CID 8021
CID 8021
CID 10197650
CID 10197650
CID 66034
CID 66034
CID 66930
CID 66930
CID 11320964
CID 11320964
CID 90424
CID 90424
CID 12618
CID 12618
CID 12202988
CID 12202988
CID 67162
CID 67162
CID 1385867
CID 1385867
CID 3793118
CID 3793118
CID 13169
CID 13169

Frequently Asked Questions

What is the IUPAC name of triethylazanium chloride?
The IUPAC name of triethylazanium chloride (CID 12698378) is triethylazanium chloride.
What is the SMILES notation for triethylazanium chloride?
The canonical SMILES for triethylazanium chloride is CC[NH+](CC)CC.[Cl-].
What is the InChIKey of triethylazanium chloride?
The InChIKey is ILWRPSCZWQJDMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.ClH/c1-4-7(5-2)6-3;/h4-6H2,1-3H3;1H.
What are the key properties of triethylazanium chloride?
triethylazanium chloride has a molecular weight of 137.65 g/mol, XLogP of -3.07, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for triethylazanium chloride is sourced from PubChem (CID 12698378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).