About [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol
[5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol (PubChem CID 126983801) has the molecular formula C8H10INO2S
and a molecular weight of 311.14 g/mol. Its IUPAC name is [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol |
| PubChem CID | 126983801 |
| Molecular Formula | C8H10INO2S |
| Molecular Weight | 311.14 g/mol |
| Exact Mass | 310.95 |
| IUPAC Name | [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol |
| SMILES | OCC1CCC(c2ncc(I)s2)O1 |
| InChI | InChI=1S/C8H10INO2S/c9-7-3-10-8(13-7)6-2-1-5(4-11)12-6/h3,5-6,11H,1-2,4H2 |
| InChIKey | AGTZETCMMLXBJV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.14 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol?
The IUPAC name of [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol (CID 126983801) is [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol.
What is the SMILES notation for [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol?
The canonical SMILES for [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol is OCC1CCC(c2ncc(I)s2)O1.
What is the InChIKey of [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol?
The InChIKey is AGTZETCMMLXBJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10INO2S/c9-7-3-10-8(13-7)6-2-1-5(4-11)12-6/h3,5-6,11H,1-2,4H2.
What are the key properties of [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol?
[5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol has a molecular weight of 311.14 g/mol, XLogP of 1.96, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(5-iodo-1,3-thiazol-2-yl)oxolan-2-yl]methanol is sourced from PubChem (CID 126983801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).