About (2E,4E)-2-methylhexa-2,4-dienedinitrile
(2E,4E)-2-methylhexa-2,4-dienedinitrile (PubChem CID 12698506) has the molecular formula C7H6N2
and a molecular weight of 118.14 g/mol. Its IUPAC name is (2E,4E)-2-methylhexa-2,4-dienedinitrile.
Molecular Properties
| Compound Name | (2E,4E)-2-methylhexa-2,4-dienedinitrile |
| PubChem CID | 12698506 |
| Molecular Formula | C7H6N2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | (2E,4E)-2-methylhexa-2,4-dienedinitrile |
| SMILES | C/C(C#N)=C\C=C\C#N |
| InChI | InChI=1S/C7H6N2/c1-7(6-9)4-2-3-5-8/h2-4H,1H3/b3-2+,7-4+ |
| InChIKey | YINBQNJDWJJHOA-AOGGBPEJSA-N |
| XLogP | 1.54 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-2-methylhexa-2,4-dienedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-2-methylhexa-2,4-dienedinitrile?
The IUPAC name of (2E,4E)-2-methylhexa-2,4-dienedinitrile (CID 12698506) is (2E,4E)-2-methylhexa-2,4-dienedinitrile.
What is the SMILES notation for (2E,4E)-2-methylhexa-2,4-dienedinitrile?
The canonical SMILES for (2E,4E)-2-methylhexa-2,4-dienedinitrile is C/C(C#N)=C\C=C\C#N.
What is the InChIKey of (2E,4E)-2-methylhexa-2,4-dienedinitrile?
The InChIKey is YINBQNJDWJJHOA-AOGGBPEJSA-N. The full InChI is InChI=1S/C7H6N2/c1-7(6-9)4-2-3-5-8/h2-4H,1H3/b3-2+,7-4+.
What are the key properties of (2E,4E)-2-methylhexa-2,4-dienedinitrile?
(2E,4E)-2-methylhexa-2,4-dienedinitrile has a molecular weight of 118.14 g/mol, XLogP of 1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-2-methylhexa-2,4-dienedinitrile is sourced from PubChem (CID 12698506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).