C11H13ClN2 — CID 126985620
6-chloro-3-ethyl-2,8-dimethylimidazo[1,2-a]pyridine (PubChem CID 126985620) has the molecular formula C11H13ClN2 and a molecular weight of 208.69 g/mol. Its IUPAC name is 6-chloro-3-ethyl-2,8-dimethylimidazo[1,2-a]pyridine.
| Compound Name | 6-chloro-3-ethyl-2,8-dimethylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 126985620 |
| Molecular Formula | C11H13ClN2 |
| Molecular Weight | 208.69 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 6-chloro-3-ethyl-2,8-dimethylimidazo[1,2-a]pyridine |
| SMILES | CCc1c(C)nc2c(C)cc(Cl)cn12 |
| InChI | InChI=1S/C11H13ClN2/c1-4-10-8(3)13-11-7(2)5-9(12)6-14(10)11/h5-6H,4H2,1-3H3 |
| InChIKey | GQKWEXQILOKZJA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.69 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |