About 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid
3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid (PubChem CID 126985703) has the molecular formula C9H13NO2S
and a molecular weight of 199.27 g/mol. Its IUPAC name is 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid.
Molecular Properties
| Compound Name | 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid |
| PubChem CID | 126985703 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid |
| SMILES | Cc1cc(C(C(=O)O)C(C)C)sn1 |
| InChI | InChI=1S/C9H13NO2S/c1-5(2)8(9(11)12)7-4-6(3)10-13-7/h4-5,8H,1-3H3,(H,11,12) |
| InChIKey | ZKWUQPMAZAZQIJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid?
The IUPAC name of 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid (CID 126985703) is 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid.
What is the SMILES notation for 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid?
The canonical SMILES for 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid is Cc1cc(C(C(=O)O)C(C)C)sn1.
What is the InChIKey of 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid?
The InChIKey is ZKWUQPMAZAZQIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-5(2)8(9(11)12)7-4-6(3)10-13-7/h4-5,8H,1-3H3,(H,11,12).
What are the key properties of 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid?
3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid has a molecular weight of 199.27 g/mol, XLogP of 2.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(3-methyl-1,2-thiazol-5-yl)butanoic acid is sourced from PubChem (CID 126985703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).