C7H9NOS2 — CID 126985770
3-(1,2-thiazol-3-yl)thiolan-3-ol (PubChem CID 126985770) has the molecular formula C7H9NOS2 and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-(1,2-thiazol-3-yl)thiolan-3-ol.
| Compound Name | 3-(1,2-thiazol-3-yl)thiolan-3-ol |
|---|---|
| PubChem CID | 126985770 |
| Molecular Formula | C7H9NOS2 |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | 3-(1,2-thiazol-3-yl)thiolan-3-ol |
| SMILES | OC1(c2ccsn2)CCSC1 |
| InChI | InChI=1S/C7H9NOS2/c9-7(2-4-10-5-7)6-1-3-11-8-6/h1,3,9H,2,4-5H2 |
| InChIKey | HQKQCUBGDXMBIU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |