About 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine
2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine (PubChem CID 126987222) has the molecular formula C7H7ClF2N2S
and a molecular weight of 224.66 g/mol. Its IUPAC name is 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine.
Molecular Properties
| Compound Name | 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine |
| PubChem CID | 126987222 |
| Molecular Formula | C7H7ClF2N2S |
| Molecular Weight | 224.66 g/mol |
| Exact Mass | 224.00 |
| IUPAC Name | 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine |
| SMILES | FC(F)[C@H]1C[C@@H]1Nc1csc(Cl)n1 |
| InChI | InChI=1S/C7H7ClF2N2S/c8-7-12-5(2-13-7)11-4-1-3(4)6(9)10/h2-4,6,11H,1H2/t3-,4-/m0/s1 |
| InChIKey | DAUKVGUMDNENHC-IMJSIDKUSA-N |
| XLogP | 2.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.66 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine?
The IUPAC name of 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine (CID 126987222) is 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine.
What is the SMILES notation for 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine?
The canonical SMILES for 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine is FC(F)[C@H]1C[C@@H]1Nc1csc(Cl)n1.
What is the InChIKey of 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine?
The InChIKey is DAUKVGUMDNENHC-IMJSIDKUSA-N. The full InChI is InChI=1S/C7H7ClF2N2S/c8-7-12-5(2-13-7)11-4-1-3(4)6(9)10/h2-4,6,11H,1H2/t3-,4-/m0/s1.
What are the key properties of 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine?
2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine has a molecular weight of 224.66 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[(1S,2S)-2-(difluoromethyl)cyclopropyl]-1,3-thiazol-4-amine is sourced from PubChem (CID 126987222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).