About 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide
3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide (PubChem CID 126987286) has the molecular formula C9H15FN2O
and a molecular weight of 186.23 g/mol. Its IUPAC name is 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide.
Molecular Properties
| Compound Name | 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide |
| PubChem CID | 126987286 |
| Molecular Formula | C9H15FN2O |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide |
| SMILES | C[C@@H]1C[C@H]1NC(=O)N1CC(C)(F)C1 |
| InChI | InChI=1S/C9H15FN2O/c1-6-3-7(6)11-8(13)12-4-9(2,10)5-12/h6-7H,3-5H2,1-2H3,(H,11,13)/t6-,7-/m1/s1 |
| InChIKey | YLBPEYBGRKXHSH-RNFRBKRXSA-N |
| XLogP | 1.15 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide?
The IUPAC name of 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide (CID 126987286) is 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide.
What is the SMILES notation for 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide?
The canonical SMILES for 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide is C[C@@H]1C[C@H]1NC(=O)N1CC(C)(F)C1.
What is the InChIKey of 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide?
The InChIKey is YLBPEYBGRKXHSH-RNFRBKRXSA-N. The full InChI is InChI=1S/C9H15FN2O/c1-6-3-7(6)11-8(13)12-4-9(2,10)5-12/h6-7H,3-5H2,1-2H3,(H,11,13)/t6-,7-/m1/s1.
What are the key properties of 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide?
3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide has a molecular weight of 186.23 g/mol, XLogP of 1.15, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-3-methyl-N-[(1R,2R)-2-methylcyclopropyl]azetidine-1-carboxamide is sourced from PubChem (CID 126987286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).