About 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione
3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione (PubChem CID 126987334) has the molecular formula C7H6N2O3S
and a molecular weight of 198.20 g/mol. Its IUPAC name is 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione |
| PubChem CID | 126987334 |
| Molecular Formula | C7H6N2O3S |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1Cc1ccon1 |
| InChI | InChI=1S/C7H6N2O3S/c10-6-4-13-7(11)9(6)3-5-1-2-12-8-5/h1-2H,3-4H2 |
| InChIKey | XNERIWNKCBNWNX-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione?
The IUPAC name of 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione (CID 126987334) is 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione.
What is the SMILES notation for 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione?
The canonical SMILES for 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione is O=C1CSC(=O)N1Cc1ccon1.
What is the InChIKey of 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione?
The InChIKey is XNERIWNKCBNWNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O3S/c10-6-4-13-7(11)9(6)3-5-1-2-12-8-5/h1-2H,3-4H2.
What are the key properties of 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione?
3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione has a molecular weight of 198.20 g/mol, XLogP of 0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-oxazol-3-ylmethyl)-1,3-thiazolidine-2,4-dione is sourced from PubChem (CID 126987334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).